CAS 198958-89-3 appears in our catalog under these names: Elarofiban TFA/ 100%, Elarofiban TFA, Elarofiban (diTFA). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid;2,2,2-trifluoroacetic acid (CAS 198958-89-3) is a chemical compound with the molecular formula C24H33F3N4O6 and a molecular weight of 530.5 g/mol. IUPAC name: (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid;2,2,2-trifluoroacetic acid. InChIKey: IACRMWDIXJQNBI-VOMIJIAVSA-N.
| Molecular formula | C24H33F3N4O6 |
|---|---|
| Molecular weight | 530.5 g/mol |
| IUPAC name | (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | IACRMWDIXJQNBI-VOMIJIAVSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)CCC2CCNCC2)C(=O)N[C@@H](CC(=O)O)C3=CN=CC=C3.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)