Products 198958-88-2
CAS 198958-88-2 appears in our catalog under these names: Elarofiban/ 99.94% (existing batch purity), Elarofiban. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 10 mg.
(3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid (CAS 198958-88-2) is a chemical compound with the molecular formula C22H32N4O4 and a molecular weight of 416.5 g/mol. IUPAC name: (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid. InChIKey: ABNXKGFLZFSILK-MOPGFXCFSA-N.
| Molecular formula | C22H32N4O4 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]-3-pyridin-3-ylpropanoic acid |
| InChIKey | ABNXKGFLZFSILK-MOPGFXCFSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)CCC2CCNCC2)C(=O)N[C@@H](CC(=O)O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)