CAS 1839524-44-5 appears in our catalog under these names: Endosidin 2, Endosidin-2/ 98.29% (existing batch purity), Endosidin2, (E)-3-Fluoro-N'-(4-hydroxy-3-iodo-5-methoxybenzylidene)benzohydrazide, Endosidin-2, 99.17%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 10mM (in 1ml dmso).
3-fluoro-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide (CAS 1839524-44-5) is a chemical compound with the molecular formula C15H12FIN2O3 and a molecular weight of 414.17 g/mol. IUPAC name: 3-fluoro-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide. InChIKey: UIADDCURKKFTFW-QGMBQPNBSA-N.
| Molecular formula | C15H12FIN2O3 |
|---|---|
| Molecular weight | 414.17 g/mol |
| IUPAC name | 3-fluoro-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide |
| InChIKey | UIADDCURKKFTFW-QGMBQPNBSA-N |
| SMILES | COC1=C(C(=CC(=C1)/C=N/NC(=O)C2=CC(=CC=C2)F)I)O |
Computed by PubChem (NCBI)