CAS 111523-41-2 appears in our catalog under these names: Enloplatin/ 99.73% (existing batch purity), Enloplatin. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
[4-(aminomethyl)oxan-4-yl]methanamine;cyclobutane-1,1-dicarboxylate;platinum(2+) (CAS 111523-41-2) is a chemical compound with the molecular formula C13H22N2O5Pt and a molecular weight of 481.41 g/mol. IUPAC name: [4-(aminomethyl)oxan-4-yl]methanamine;cyclobutane-1,1-dicarboxylate;platinum(2+). InChIKey: ASQRQYODAQUVBR-UHFFFAOYSA-L.
| Molecular formula | C13H22N2O5Pt |
|---|---|
| Molecular weight | 481.41 g/mol |
| IUPAC name | [4-(aminomethyl)oxan-4-yl]methanamine;cyclobutane-1,1-dicarboxylate;platinum(2+) |
| InChIKey | ASQRQYODAQUVBR-UHFFFAOYSA-L |
| SMILES | C1CC(C1)(C(=O)[O-])C(=O)[O-].C1COCCC1(CN)CN.[Pt+2] |
Computed by PubChem (NCBI)