CAS 2883495-39-2 appears in our catalog under these names: Enpp/Carbonic anhydrase–IN–2, Enpp/Carbonic anhydrase-IN-2 99%, Enpp/Carbonic anhydrase-IN-2, 98.48%, Enpp/Carbonic anhydrase-IN-2/ 99.13% (existing batch purity), 4-[(Tricyclo[3.3.1.13,7]dec-1-ylcarbonyl)amino]phenyl 4-fluorobenzenesulfonate, 98%, 98%. Offered by: GLPBio, Ambeed, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 1mg, 100mg.
[4-(adamantane-1-carbonylamino)phenyl] 4-fluorobenzenesulfonate (CAS 2883495-39-2) is a chemical compound with the molecular formula C23H24FNO4S and a molecular weight of 429.5 g/mol. IUPAC name: [4-(adamantane-1-carbonylamino)phenyl] 4-fluorobenzenesulfonate. InChIKey: LLXLLGJJXOHBLG-UHFFFAOYSA-N.
| Molecular formula | C23H24FNO4S |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | [4-(adamantane-1-carbonylamino)phenyl] 4-fluorobenzenesulfonate |
| InChIKey | LLXLLGJJXOHBLG-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC4=CC=C(C=C4)OS(=O)(=O)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)