CAS 2095719-90-5 appears in our catalog under these names: ERK1/2 inhibitor 1, ERK1/2 inhibitor 1, 99%, ERK1/2 inhibitor 1/ 99.09% (existing batch purity), Erk1/2 inhibitor 1, ERK1/2 inhibitor 1, 99.58%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 1 mg, 10 mg.
(2R)-2-[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]propanamide (CAS 2095719-90-5) is a chemical compound with the molecular formula C29H32ClN5O4 and a molecular weight of 550.0 g/mol. IUPAC name: (2R)-2-[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]propanamide. InChIKey: XHOJEECXVUMYMF-IQGLISFBSA-N.
| Molecular formula | C29H32ClN5O4 |
|---|---|
| Molecular weight | 550.0 g/mol |
| IUPAC name | (2R)-2-[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]-N-[(1S)-2-hydroxy-1-(3-methylphenyl)ethyl]propanamide |
| InChIKey | XHOJEECXVUMYMF-IQGLISFBSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H](CO)NC(=O)[C@@H](C)N2CC3=C(C2=O)C=C(C=C3)C4=NC(=NC=C4Cl)NC5CCOCC5 |
Computed by PubChem (NCBI)