cas: 81161-17-3 — see every product listed under this CAS number, including other names
Esmolol hydrochloride, 99%, 99% (CAS 81161-17-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1166C5-100mg |
| cas | 81161-17-3 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Chemat | 100g | 1442.00 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 50g | 765.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride (CAS 81161-17-3) is a chemical compound with the molecular formula C16H26ClNO4 and a molecular weight of 331.8 g/mol. IUPAC name: methyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride. InChIKey: GEKNCWBANDDJJL-UHFFFAOYSA-N.
| Molecular formula | C16H26ClNO4 |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | methyl 3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]propanoate;hydrochloride |
| InChIKey | GEKNCWBANDDJJL-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCC(=O)OC)O.Cl |
Computed by PubChem (NCBI)