CAS 1346746-38-0 is the registry number for Esmolol-d7 HCl. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 3-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]propanoate;hydrochloride (CAS 1346746-38-0) is a chemical compound with the molecular formula C16H26ClNO4 and a molecular weight of 338.88 g/mol. IUPAC name: methyl 3-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]propanoate;hydrochloride. InChIKey: GEKNCWBANDDJJL-ODLOEXKQSA-N.
| Molecular formula | C16H26ClNO4 |
|---|---|
| Molecular weight | 338.88 g/mol |
| IUPAC name | methyl 3-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]propanoate;hydrochloride |
| InChIKey | GEKNCWBANDDJJL-ODLOEXKQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CCC(=O)OC)O.Cl |
Computed by PubChem (NCBI)