cas: 5571-36-8 — see every product listed under this CAS number, including other names
Estradiene dione-3-keta, 95% (CAS 5571-36-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319513-1G |
| cas | 5571-36-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 138.51 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 659.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(8S,13S,14S)-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (CAS 5571-36-8) is a chemical compound with the molecular formula C20H26O3 and a molecular weight of 314.4 g/mol. IUPAC name: (8S,13S,14S)-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one. InChIKey: XUOQKQRMICQUQC-AOIWGVFYSA-N.
| Molecular formula | C20H26O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (8S,13S,14S)-13-methylspiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| InChIKey | XUOQKQRMICQUQC-AOIWGVFYSA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CCC2=O)CCC4=C3CCC5(C4)OCCO5 |
Computed by PubChem (NCBI)