CAS 1383782-13-5 appears in our catalog under these names: Ulipristal Impurity 6, Trenbolone Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(8S,13S,14S,17R)-17-acetyl-17-hydroxy-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (CAS 1383782-13-5) is a chemical compound with the molecular formula C20H26O3 and a molecular weight of 314.4 g/mol. IUPAC name: (8S,13S,14S,17R)-17-acetyl-17-hydroxy-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: SRCLPJHLUTVQMM-FYQPLNBISA-N.
| Molecular formula | C20H26O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (8S,13S,14S,17R)-17-acetyl-17-hydroxy-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | SRCLPJHLUTVQMM-FYQPLNBISA-N |
| SMILES | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC=C3[C@H]2CCC4=C3CCC(=O)C4)C)O |
Computed by PubChem (NCBI)