CAS 14034-59-4 appears in our catalog under these names: Clonidine Impurity 4 (Ethylenediamine p-toluenesulfonate), Ethane-1,2-diamine Mono(4-methylbenzenesulphonate), Xylometazoline EP Impurity E, Xylometazoline Impurity 5（Xylometazoline EP Impurity E）, Ethylenediamine P-Toluenesulfonate, >95% (HPLC). Offered by: Chemat Brand, Mikromol, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
Ethane-1,2-diamine;4-methylbenzenesulfonic acid (CAS 14034-59-4) is a chemical compound with the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. IUPAC name: ethane-1,2-diamine;4-methylbenzenesulfonic acid. InChIKey: HVCCFMAPGCBCHZ-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O3S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | ethane-1,2-diamine;4-methylbenzenesulfonic acid |
| InChIKey | HVCCFMAPGCBCHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C(CN)N |
Computed by PubChem (NCBI)