CAS 2059911-11-2 appears in our catalog under these names: tert-Butyl N-((4R)-2-methyl-3-oxo-1,2-thiazolidin-4-yl)carbamate, 95%, tert-Butyl N-((4R)-2-methyl-3-oxo-1,2-thiazolidin-4-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-[(4R)-2-methyl-3-oxo-1,2-thiazolidin-4-yl]carbamate (CAS 2059911-11-2) is a chemical compound with the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. IUPAC name: tert-butyl N-[(4R)-2-methyl-3-oxo-1,2-thiazolidin-4-yl]carbamate. InChIKey: NFBOSHPXMDWYFS-LURJTMIESA-N.
| Molecular formula | C9H16N2O3S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | tert-butyl N-[(4R)-2-methyl-3-oxo-1,2-thiazolidin-4-yl]carbamate |
| InChIKey | NFBOSHPXMDWYFS-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CSN(C1=O)C |
Computed by PubChem (NCBI)