cas: 175543-23-4 — see every product listed under this CAS number, including other names
Ethyl 2,2-Difluoro-2-(4-fluorophenyl)acetate, ≥95%, ≥95% (CAS 175543-23-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113224-1g |
| cas | 175543-23-4 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 328.40 Pln | |
| Chemat | 25g | 2195.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2,2-difluoro-2-(4-fluorophenyl)acetate (CAS 175543-23-4) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(4-fluorophenyl)acetate. InChIKey: QTJOXVLRFWKBMD-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(4-fluorophenyl)acetate |
| InChIKey | QTJOXVLRFWKBMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)F)(F)F |
Computed by PubChem (NCBI)