cas: 94695-50-8 — see every product listed under this CAS number, including other names
Ethyl 2,3,4,5-tetrafluorobenzoyl acetate, 97% (CAS 94695-50-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214767-25G |
| cas | 94695-50-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 393.63 Pln | |
| Fluorochem | 500g | 1606.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate (CAS 94695-50-8) is a chemical compound with the molecular formula C11H8F4O3 and a molecular weight of 264.17 g/mol. IUPAC name: ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate. InChIKey: KWDVJYLIAJHEOW-UHFFFAOYSA-N.
| Molecular formula | C11H8F4O3 |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate |
| InChIKey | KWDVJYLIAJHEOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)