cas: 94695-50-8 — see every product listed under this CAS number, including other names
Ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate 97% (CAS 94695-50-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A322769-5g |
| cas | 94695-50-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 437.12 Pln | |
| Ambeed | 500g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A322769 |
Ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate (CAS 94695-50-8) is a chemical compound with the molecular formula C11H8F4O3 and a molecular weight of 264.17 g/mol. IUPAC name: ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate. InChIKey: KWDVJYLIAJHEOW-UHFFFAOYSA-N.
| Molecular formula | C11H8F4O3 |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate |
| InChIKey | KWDVJYLIAJHEOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)