cas: 122539-74-6 — see every product listed under this CAS number, including other names
Ethyl 2-(((trifluoromethyl)sulfonyl)oxy)cyclopent-1-enecarboxylate 95% (CAS 122539-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A492978-250mg |
| cas | 122539-74-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2534.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A492978 |
Ethyl 2-(trifluoromethylsulfonyloxy)cyclopentene-1-carboxylate (CAS 122539-74-6) is a chemical compound with the molecular formula C9H11F3O5S and a molecular weight of 288.24 g/mol. IUPAC name: ethyl 2-(trifluoromethylsulfonyloxy)cyclopentene-1-carboxylate. InChIKey: ZFLPJHGXVFJDCI-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O5S |
|---|---|
| Molecular weight | 288.24 g/mol |
| IUPAC name | ethyl 2-(trifluoromethylsulfonyloxy)cyclopentene-1-carboxylate |
| InChIKey | ZFLPJHGXVFJDCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(CCC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)