CAS 889944-72-3 appears in our catalog under these names: Ethyl 2–(2,4,6–trichloropyrimidin–5–yl)acetate, 2,4,6-Trichloro-5-pyrimidineacetic acid ethyl ester, 98%, 98%, Ethyl 2-(2,4,6-trichloropyrimidin-5-yl)acetate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
Ethyl 2-(2,4,6-trichloropyrimidin-5-yl)acetate (CAS 889944-72-3) is a chemical compound with the molecular formula C8H7Cl3N2O2 and a molecular weight of 269.5 g/mol. IUPAC name: ethyl 2-(2,4,6-trichloropyrimidin-5-yl)acetate. InChIKey: BBZKVKDEGXYGDA-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2O2 |
|---|---|
| Molecular weight | 269.5 g/mol |
| IUPAC name | ethyl 2-(2,4,6-trichloropyrimidin-5-yl)acetate |
| InChIKey | BBZKVKDEGXYGDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(N=C(N=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)