CAS 2381-77-3 is the registry number for 2-(2,4,5-Trichlorophenoxy)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,4,5-trichlorophenoxy)acetohydrazide (CAS 2381-77-3) is a chemical compound with the molecular formula C8H7Cl3N2O2 and a molecular weight of 269.5 g/mol. IUPAC name: 2-(2,4,5-trichlorophenoxy)acetohydrazide. InChIKey: RJNOGGWECYOHOH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2O2 |
|---|---|
| Molecular weight | 269.5 g/mol |
| IUPAC name | 2-(2,4,5-trichlorophenoxy)acetohydrazide |
| InChIKey | RJNOGGWECYOHOH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC(=O)NN |
Computed by PubChem (NCBI)