cas: 1442471-26-2 — see every product listed under this CAS number, including other names
Ethyl 2-(5-amino-2-bromo-4-fluorophenyl)acetate, 98% (CAS 1442471-26-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616435-25MG |
| cas | 1442471-26-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 601.89 Pln | |
| Fluorochem | 100mg | 1263.11 Pln | |
| Fluorochem | 250mg | 1861.86 Pln | |
| Fluorochem | 1g | 4579.66 Pln | |
| Fluorochem | 5g | 20475.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(5-amino-2-bromo-4-fluorophenyl)acetate (CAS 1442471-26-2) is a chemical compound with the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. IUPAC name: ethyl 2-(5-amino-2-bromo-4-fluorophenyl)acetate. InChIKey: JPQNPPCKEMAVMD-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO2 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | ethyl 2-(5-amino-2-bromo-4-fluorophenyl)acetate |
| InChIKey | JPQNPPCKEMAVMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1Br)F)N |
Computed by PubChem (NCBI)