Products 1478009-99-2
CAS 1478009-99-2 is the registry number for 2-(4-Bromo-3-fluoro-phenoxy)-n,n-dimethyl-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-bromo-3-fluorophenoxy)-N,N-dimethylacetamide (CAS 1478009-99-2) is a chemical compound with the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenoxy)-N,N-dimethylacetamide. InChIKey: IDYUPRWGQUOUGO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO2 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenoxy)-N,N-dimethylacetamide |
| InChIKey | IDYUPRWGQUOUGO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)