cas: 200204-85-9 — see every product listed under this CAS number, including other names
Ethyl 2-(5-bromobenzofuran-3-yl)acetate 97% (CAS 200204-85-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109237-100mg |
| cas | 200204-85-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 4692.44 Pln | |
| Ambeed | 25g | 17013.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109237 |
Ethyl 2-(5-bromo-1-benzofuran-3-yl)acetate (CAS 200204-85-9) is a chemical compound with the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. IUPAC name: ethyl 2-(5-bromo-1-benzofuran-3-yl)acetate. InChIKey: NWCIURORZMAWNA-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO3 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | ethyl 2-(5-bromo-1-benzofuran-3-yl)acetate |
| InChIKey | NWCIURORZMAWNA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=COC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)