Products 1000400-78-1
CAS 1000400-78-1 is the registry number for Ethyl 4-(4-bromophenyl)-2-oxobut-3-enoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Ethyl (E)-4-(4-bromophenyl)-2-oxobut-3-enoate (CAS 1000400-78-1) is a chemical compound with the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. IUPAC name: ethyl (E)-4-(4-bromophenyl)-2-oxobut-3-enoate. InChIKey: OQTWXANQNYBTKQ-VMPITWQZSA-N.
| Molecular formula | C12H11BrO3 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | ethyl (E)-4-(4-bromophenyl)-2-oxobut-3-enoate |
| InChIKey | OQTWXANQNYBTKQ-VMPITWQZSA-N |
| SMILES | CCOC(=O)C(=O)/C=C/C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)