cas: 80589-50-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride, 97% (CAS 80589-50-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F661811-500MG |
| cas | 80589-50-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 778.91 Pln | |
| Fluorochem | 1g | 1127.75 Pln | |
| Fluorochem | 5g | 3246.79 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 80589-50-0) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: ethyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: LRTVYMMSQHSIIN-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | ethyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride |
| InChIKey | LRTVYMMSQHSIIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)