CAS 80589-50-0 appears in our catalog under these names: Ethyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride, 95%, Ethyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
Ethyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 80589-50-0) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: ethyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: LRTVYMMSQHSIIN-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | ethyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride |
| InChIKey | LRTVYMMSQHSIIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)