cas: 1242140-62-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-bromo-1H-indole-3-carboxylate, 98%, 98% (CAS 1242140-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTMM-250mg |
| cas | 1242140-62-0 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 5g | 3179.60 Pln | |
| Chemat | 10g | 6266.00 Pln | |
| Chemat | 100mg | 136.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-5-bromo-1H-indole-3-carboxylate (CAS 1242140-62-0) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: ethyl 2-amino-5-bromo-1H-indole-3-carboxylate. InChIKey: JEEONSIWPYAQME-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | ethyl 2-amino-5-bromo-1H-indole-3-carboxylate |
| InChIKey | JEEONSIWPYAQME-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C1C=C(C=C2)Br)N |
Computed by PubChem (NCBI)