Products 52448-16-5
CAS 52448-16-5 appears in our catalog under these names: (S)-2-Amino-3-(4-bromo-1h-indol-3-yl)propanoic acid, 95%, 4–Bromo–L–tryptophan, 4-Bromo-L-tryptophan, H-Trp(4-Br)-OH 95%, (S)-2-Amino-3-(4-bromo-1H-indol-3-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 0,025g, 0,01g, 0,05g, 0,1g, 0,25g.
(2S)-2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid (CAS 52448-16-5) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2S)-2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid. InChIKey: OFKIVYVSESEHFZ-QMMMGPOBSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | OFKIVYVSESEHFZ-QMMMGPOBSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Amino-3-(4-bromo-1H-indol-3-yl)propanoic acid, 4-bromotryptophan, (S)-2-Amino-3-(4-bromo-1H-indol-3-yl)propanoicacid, L-Tryptophan, 4-bromo-, L-Trp(4-Br)-OH, H-L-Trp(4-Br)-OH, L-2-Amino-3-(4-bromoindolyl)propionic acid, 4-Bromo-L-tryptophan (H-L-Trp(4-Br)-OH), 4-Bromo-L-tryptophan>/= 98% (HPLC, Chiral purity)