cas: 1153284-99-1 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-4-fluoro-5-nitrobenzoate 95% (CAS 1153284-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1129560-100mg |
| cas | 1153284-99-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2144.81 Pln | |
| Ambeed | 25g | 10432.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1129560 |
Ethyl 2-bromo-4-fluoro-5-nitrobenzoate (CAS 1153284-99-1) is a chemical compound with the molecular formula C9H7BrFNO4 and a molecular weight of 292.06 g/mol. IUPAC name: ethyl 2-bromo-4-fluoro-5-nitrobenzoate. InChIKey: ULCUEMGHPKGASH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO4 |
|---|---|
| Molecular weight | 292.06 g/mol |
| IUPAC name | ethyl 2-bromo-4-fluoro-5-nitrobenzoate |
| InChIKey | ULCUEMGHPKGASH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)