cas: 1153284-99-1 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-4-fluoro-5-nitrobenzoate, 95%, 95% (CAS 1153284-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AHNJ-100mg |
| cas | 1153284-99-1 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 842.00 Pln | |
| Chemat | 5g | 2094.80 Pln | |
| Chemat | 25g | 5147.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-bromo-4-fluoro-5-nitrobenzoate (CAS 1153284-99-1) is a chemical compound with the molecular formula C9H7BrFNO4 and a molecular weight of 292.06 g/mol. IUPAC name: ethyl 2-bromo-4-fluoro-5-nitrobenzoate. InChIKey: ULCUEMGHPKGASH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO4 |
|---|---|
| Molecular weight | 292.06 g/mol |
| IUPAC name | ethyl 2-bromo-4-fluoro-5-nitrobenzoate |
| InChIKey | ULCUEMGHPKGASH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)