cas: 78485-37-7 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-6-benzothiazolecarboxylate, 98%, 98% (CAS 78485-37-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116491-250mg |
| cas | 78485-37-7 |
| size | 250mg |
| availability | 52g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 904.40 Pln | |
| Chemat | 50g | 1442.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-chloro-1,3-benzothiazole-6-carboxylate (CAS 78485-37-7) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: ethyl 2-chloro-1,3-benzothiazole-6-carboxylate. InChIKey: XISSCVMIXDMKLH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | ethyl 2-chloro-1,3-benzothiazole-6-carboxylate |
| InChIKey | XISSCVMIXDMKLH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(S2)Cl |
Computed by PubChem (NCBI)