cas: 78485-37-7 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-6-benzothiazolecarboxylate 97% (CAS 78485-37-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A155247-1g |
| cas | 78485-37-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 681.88 Pln | |
| Ambeed | 25g | 1588.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A155247 |
Ethyl 2-chloro-1,3-benzothiazole-6-carboxylate (CAS 78485-37-7) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: ethyl 2-chloro-1,3-benzothiazole-6-carboxylate. InChIKey: XISSCVMIXDMKLH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | ethyl 2-chloro-1,3-benzothiazole-6-carboxylate |
| InChIKey | XISSCVMIXDMKLH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(S2)Cl |
Computed by PubChem (NCBI)