cas: 84186-23-2 — see every product listed under this CAS number, including other names
Ethyl 2-cyano-3-(2-fluorophenyl)acrylate, 98% (CAS 84186-23-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A255722-25g |
| cas | 84186-23-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 10902.64 Pln | |
| AmBeed | 100mg | 525.70 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl (E)-2-cyano-3-(2-fluorophenyl)prop-2-enoate (CAS 84186-23-2) is a chemical compound with the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(2-fluorophenyl)prop-2-enoate. InChIKey: HAYFYQCUACVOEL-JXMROGBWSA-N.
| Molecular formula | C12H10FNO2 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(2-fluorophenyl)prop-2-enoate |
| InChIKey | HAYFYQCUACVOEL-JXMROGBWSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=CC=C1F)/C#N |
Computed by PubChem (NCBI)