CAS 1107650-67-8 appears in our catalog under these names: Fluorofenidone Impurity 1, Fluorofenidone Impurity 1-d3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(3-fluorophenyl)-5-(hydroxymethyl)pyridin-2-one (CAS 1107650-67-8) is a chemical compound with the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. IUPAC name: 1-(3-fluorophenyl)-5-(hydroxymethyl)pyridin-2-one. InChIKey: JBJWRDYSISSMGN-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-5-(hydroxymethyl)pyridin-2-one |
| InChIKey | JBJWRDYSISSMGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=C(C=CC2=O)CO |
Computed by PubChem (NCBI)