Ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate, 95%
cas: 561002-04-8 — see every product listed under this CAS number, including other names
Ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate, 95% (CAS 561002-04-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1087863-100mg |
| cas | 561002-04-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 3357.44 Pln | |
| BLDpharm | 100mg | 741.99 Pln | |
| BLDpharm | 250mg | 1247.36 Pln | |
| BLDpharm | 1g | 3291.09 Pln | |
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 1898.00 Pln | |
| Fluorochem | 100mg | 773.70 Pln | |
| Fluorochem | 250mg | 1309.97 Pln | |
| Fluorochem | 1g | 3429.02 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (CAS 561002-04-8) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate. InChIKey: PUNQZWZQISOPOW-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| InChIKey | PUNQZWZQISOPOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(N=C2N1C=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate, ethyl 2-oxo-2-{2-phenylimidazo[1,2-a]pyridin-3-yl}acetate, ethyl oxo(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate, ethyl2-oxo-2-{2-phenylimidazo[1,2-a]pyridin-3-yl}acetate, Imidazo[1,2-a]pyridine-3-acetic acid, alpha-oxo-2-phenyl-, ethyl ester