Ethyl 2-phenylpyrimidine-5-carboxylate, 98%
cas: 85386-14-7 — see every product listed under this CAS number, including other names
Ethyl 2-phenylpyrimidine-5-carboxylate, 98% (CAS 85386-14-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A143342-250mg |
| cas | 85386-14-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1755.44 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1504.40 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 1819.38 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1804.59 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-phenylpyrimidine-5-carboxylate (CAS 85386-14-7) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: ethyl 2-phenylpyrimidine-5-carboxylate. InChIKey: ADXNMWBLJLAMNG-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | ethyl 2-phenylpyrimidine-5-carboxylate |
| InChIKey | ADXNMWBLJLAMNG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)