Products 935687-49-3
CAS 935687-49-3 appears in our catalog under these names: Benzyl 6-aminonicotinate, 96%, Benzyl 6-aminonicotinate, 98%, Benzyl 6-aminonicotinate 96%, Benzyl 6-aminonicotinate, 95%, 95%, Benzyl 6-aminonicotinate, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Benzyl 6-aminopyridine-3-carboxylate (CAS 935687-49-3) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: benzyl 6-aminopyridine-3-carboxylate. InChIKey: WZFRFMFRNZBTPU-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | benzyl 6-aminopyridine-3-carboxylate |
| InChIKey | WZFRFMFRNZBTPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)