cas: 62224-22-0 — see every product listed under this CAS number, including other names
Ethyl 3,5-dibromothiophene-2-carboxylate, 98% (CAS 62224-22-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1635209-25g |
| cas | 62224-22-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 58549.33 Pln | |
| AmBeed | 10g | 29859.76 Pln | |
| AmBeed | 5g | 17588.41 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 3,5-dibromothiophene-2-carboxylate (CAS 62224-22-0) is a chemical compound with the molecular formula C7H6Br2O2S and a molecular weight of 314.00 g/mol. IUPAC name: ethyl 3,5-dibromothiophene-2-carboxylate. InChIKey: CYQHUIACPXDUIL-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2O2S |
|---|---|
| Molecular weight | 314.00 g/mol |
| IUPAC name | ethyl 3,5-dibromothiophene-2-carboxylate |
| InChIKey | CYQHUIACPXDUIL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(S1)Br)Br |
Computed by PubChem (NCBI)