Products 1222407-24-0
CAS 1222407-24-0 appears in our catalog under these names: 1,3-Dibromo-5-methanesulfonylbenzene, 95%, 1,3-dibromo-5-methanesulfonylbenzene, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
1,3-dibromo-5-methylsulfonylbenzene (CAS 1222407-24-0) is a chemical compound with the molecular formula C7H6Br2O2S and a molecular weight of 314.00 g/mol. IUPAC name: 1,3-dibromo-5-methylsulfonylbenzene. InChIKey: GPQCGXKXBLIDAB-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2O2S |
|---|---|
| Molecular weight | 314.00 g/mol |
| IUPAC name | 1,3-dibromo-5-methylsulfonylbenzene |
| InChIKey | GPQCGXKXBLIDAB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)