cas: 101987-86-4 — see every product listed under this CAS number, including other names
Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate, 97% (CAS 101987-86-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F225655-1G |
| cas | 101987-86-4 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 211.40 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 924.69 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 898.81 Pln | |
| Ambeed | 500g | 3935.94 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS 101987-86-4) is a chemical compound with the molecular formula C11H8ClF3O3 and a molecular weight of 280.63 g/mol. IUPAC name: ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate. InChIKey: LZMXLCPYJNRWNQ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClF3O3 |
|---|---|
| Molecular weight | 280.63 g/mol |
| IUPAC name | ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate |
| InChIKey | LZMXLCPYJNRWNQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C(=C1F)Cl)F)F |
Computed by PubChem (NCBI)