CAS 75381-63-4 is the registry number for 4-(4-Chloro-3-(trifluoromethyl)phenyl)-4-oxobutanoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxobutanoic acid (CAS 75381-63-4) is a chemical compound with the molecular formula C11H8ClF3O3 and a molecular weight of 280.63 g/mol. IUPAC name: 4-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxobutanoic acid. InChIKey: JBJLYQMZIUGOMC-UHFFFAOYSA-N.
| Molecular formula | C11H8ClF3O3 |
|---|---|
| Molecular weight | 280.63 g/mol |
| IUPAC name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxobutanoic acid |
| InChIKey | JBJLYQMZIUGOMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCC(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)