cas: 1350989-93-3 — see every product listed under this CAS number, including other names
Ethyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%, 98% (CAS 1350989-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110X2B-100mg |
| cas | 1350989-93-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1350989-93-3) is a chemical compound with the molecular formula C15H22BNO4 and a molecular weight of 291.15 g/mol. IUPAC name: ethyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: FVDWZYDAKIIASA-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | ethyl 3-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | FVDWZYDAKIIASA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OCC)N |
Computed by PubChem (NCBI)