Ethyl 3-fluoro-2-methylbenzoate, 98%
cas: 114312-57-1 — see every product listed under this CAS number, including other names
Ethyl 3-fluoro-2-methylbenzoate, 98% (CAS 114312-57-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A252345-1g |
| cas | 114312-57-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 1021.19 Pln | |
| Ambeed | 25g | 2117.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 299.60 Pln | |
| Chemat | 10g | 539.60 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 608.70 Pln | |
| BLDpharm | 10g | 1097.42 Pln | |
| BLDpharm | 25g | 2280.33 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 1039.24 Pln | |
| Fluorochem | 25g | 2169.05 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 3-fluoro-2-methylbenzoate (CAS 114312-57-1) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: ethyl 3-fluoro-2-methylbenzoate. InChIKey: CYBRUQHZUVUAHN-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | ethyl 3-fluoro-2-methylbenzoate |
| InChIKey | CYBRUQHZUVUAHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)F)C |
Computed by PubChem (NCBI)