CAS 26584-27-0 appears in our catalog under these names: Methyl 2,4-dimethyl-3-fluorobenzoate, 95%, 2,4-Dimethyl-3-fluorobenzoic acid methyl ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 3-fluoro-2,4-dimethylbenzoate (CAS 26584-27-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: methyl 3-fluoro-2,4-dimethylbenzoate. InChIKey: ACOITQPWFKGOIV-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | methyl 3-fluoro-2,4-dimethylbenzoate |
| InChIKey | ACOITQPWFKGOIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)C)F |
Computed by PubChem (NCBI)