CAS 945-93-7 appears in our catalog under these names: Ethyl 3-phenylbut-2-enoate (E/Z mixture), 98%, Ethyl 3-phenylbut-2-enoate, Ethyl 3-phenylbut-2-enoate (E/Z mixture), 98%, 98%, Ethyl 3-Phenylbut-2-enoate, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10000mg, 5000mg, 100mg, 250mg.
Ethyl (E)-3-phenylbut-2-enoate (CAS 945-93-7) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: ethyl (E)-3-phenylbut-2-enoate. InChIKey: BSXHSWOMMFBMLL-MDZDMXLPSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | ethyl (E)-3-phenylbut-2-enoate |
| InChIKey | BSXHSWOMMFBMLL-MDZDMXLPSA-N |
| SMILES | CCOC(=O)/C=C(\C)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)