cas: 53839-71-7 — see every product listed under this CAS number, including other names
Ethyl 4-(3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenamido)benzoate, 95%, 95% (CAS 53839-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0LW-100mg |
| cas | 53839-71-7 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate (CAS 53839-71-7) is a chemical compound with the molecular formula C29H37NO3 and a molecular weight of 447.6 g/mol. IUPAC name: ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate. InChIKey: VRSMJNVXOITYPE-FSDIUQKZSA-N.
| Molecular formula | C29H37NO3 |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate |
| InChIKey | VRSMJNVXOITYPE-FSDIUQKZSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(CCCC2(C)C)C |
Computed by PubChem (NCBI)