CAS 53839-71-7 appears in our catalog under these names: Viaminate, 95%, Viaminate, Viaminate, >95% (HPLC), Viaminate 95%, Ethyl 4-(3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenamido)benzoate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 5g, 1g, 250mg, on request, 100mg, 10mg, 5mg, 5 mg.
Ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate (CAS 53839-71-7) is a chemical compound with the molecular formula C29H37NO3 and a molecular weight of 447.6 g/mol. IUPAC name: ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate. InChIKey: VRSMJNVXOITYPE-FSDIUQKZSA-N.
| Molecular formula | C29H37NO3 |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | ethyl 4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]benzoate |
| InChIKey | VRSMJNVXOITYPE-FSDIUQKZSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(CCCC2(C)C)C |
Computed by PubChem (NCBI)