cas: 31686-94-9 — see every product listed under this CAS number, including other names
Ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate 98% (CAS 31686-94-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125794-250mg |
| cas | 31686-94-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 832.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A125794 |
Ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate (CAS 31686-94-9) is a chemical compound with the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. IUPAC name: ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate. InChIKey: LVLZSYCLOPEBSR-UHFFFAOYSA-N.
| Molecular formula | C12H11FO4 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate |
| InChIKey | LVLZSYCLOPEBSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)