cas: 31686-94-9 — see every product listed under this CAS number, including other names
Ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate, 97%, 97% (CAS 31686-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLG3-100mg |
| cas | 31686-94-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate (CAS 31686-94-9) is a chemical compound with the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. IUPAC name: ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate. InChIKey: LVLZSYCLOPEBSR-UHFFFAOYSA-N.
| Molecular formula | C12H11FO4 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | ethyl 4-(4-fluorophenyl)-2,4-dioxobutanoate |
| InChIKey | LVLZSYCLOPEBSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)