cas: 1363166-21-5 — see every product listed under this CAS number, including other names
Ethyl 4-Boc-2-homomorpholinecarboxylate, >95%, >95% (CAS 1363166-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122MP-100mg |
| cas | 1363166-21-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1029.20 Pln | |
| Chemat | 250mg | 1542.80 Pln | |
| Chemat | 1g | 4542.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
4-O-tert-butyl 2-O-ethyl 1,4-oxazepane-2,4-dicarboxylate (CAS 1363166-21-5) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 4-O-tert-butyl 2-O-ethyl 1,4-oxazepane-2,4-dicarboxylate. InChIKey: NFMNWHFTGYMZQU-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-ethyl 1,4-oxazepane-2,4-dicarboxylate |
| InChIKey | NFMNWHFTGYMZQU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CCCO1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)