Products 1393440-06-6
CAS 1393440-06-6 is the registry number for (4R,5R)-3-tert-Butyl 4-methyl 2,2,5-trimethyloxazolidine-3,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.
3-O-tert-butyl 4-O-methyl (4R,5R)-2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 1393440-06-6) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (4R,5R)-2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: FRSJJRXFHYGDSO-RKDXNWHRSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl (4R,5R)-2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | FRSJJRXFHYGDSO-RKDXNWHRSA-N |
| SMILES | C[C@@H]1[C@@H](N(C(O1)(C)C)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)