Products 952183-53-8
CAS 952183-53-8 appears in our catalog under these names: Ethyl 4–Cyano–3–Fluorobenzoate, Ethyl 4-cyano-3-fluorobenzoate, 95%, 95%, Ethyl 4-cyano-3-fluorobenzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
Ethyl 4-cyano-3-fluorobenzoate (CAS 952183-53-8) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: ethyl 4-cyano-3-fluorobenzoate. InChIKey: OEYSQQVQGGLOQP-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | ethyl 4-cyano-3-fluorobenzoate |
| InChIKey | OEYSQQVQGGLOQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C#N)F |
Computed by PubChem (NCBI)